C21H14Cl2N2O2 — CID 3492666
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-1-(3-chloro-4-methoxyphenyl)methanimine (PubChem CID 3492666) has the molecular formula C21H14Cl2N2O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-1-(3-chloro-4-methoxyphenyl)methanimine.
| Compound Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-1-(3-chloro-4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3492666 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-1-(3-chloro-4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/c2ccc(-c3nc4cc(Cl)ccc4o3)cc2)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O2/c1-26-19-8-2-13(10-17(19)23)12-24-16-6-3-14(4-7-16)21-25-18-11-15(22)5-9-20(18)27-21/h2-12H,1H3/b24-12+ |
| InChIKey | UPWHIZVDGLSFAI-WYMPLXKRSA-N |
| XLogP | 6.56 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|