C22H17ClN2O3 — CID 1204829
4-chloro-2-methoxy-6-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 1204829) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is 4-chloro-2-methoxy-6-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-methoxy-6-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 1204829 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-chloro-2-methoxy-6-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | COc1cc(Cl)cc(/C=N/c2ccc(-c3nc4cc(C)ccc4o3)cc2)c1O |
| InChI | InChI=1S/C22H17ClN2O3/c1-13-3-8-19-18(9-13)25-22(28-19)14-4-6-17(7-5-14)24-12-15-10-16(23)11-20(27-2)21(15)26/h3-12,26H,1-2H3/b24-12+ |
| InChIKey | BNEXHICVPXWYLE-WYMPLXKRSA-N |
| XLogP | 5.92 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|