C21H15IN2O — CID 4099153
1-(4-iodophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine (PubChem CID 4099153) has the molecular formula C21H15IN2O and a molecular weight of 438.27 g/mol. Its IUPAC name is 1-(4-iodophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-iodophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 4099153 |
| Molecular Formula | C21H15IN2O |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 1-(4-iodophenyl)-N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
| SMILES | Cc1ccc2oc(-c3cccc(/N=C/c4ccc(I)cc4)c3)nc2c1 |
| InChI | InChI=1S/C21H15IN2O/c1-14-5-10-20-19(11-14)24-21(25-20)16-3-2-4-18(12-16)23-13-15-6-8-17(22)9-7-15/h2-13H,1H3/b23-13+ |
| InChIKey | BOQHSGCDXSGPDT-YDZHTSKRSA-N |
| XLogP | 6.16 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|