C22H16BrN3O3 — CID 3511707
4-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(6-methyl-1H-benzimidazol-2-yl)phenol (PubChem CID 3511707) has the molecular formula C22H16BrN3O3 and a molecular weight of 450.29 g/mol. Its IUPAC name is 4-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(6-methyl-1H-benzimidazol-2-yl)phenol.
| Compound Name | 4-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(6-methyl-1H-benzimidazol-2-yl)phenol |
|---|---|
| PubChem CID | 3511707 |
| Molecular Formula | C22H16BrN3O3 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 4-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(6-methyl-1H-benzimidazol-2-yl)phenol |
| SMILES | Cc1ccc2nc(-c3cc(/N=C/c4cc5c(cc4Br)OCO5)ccc3O)[nH]c2c1 |
| InChI | InChI=1S/C22H16BrN3O3/c1-12-2-4-17-18(6-12)26-22(25-17)15-8-14(3-5-19(15)27)24-10-13-7-20-21(9-16(13)23)29-11-28-20/h2-10,27H,11H2,1H3,(H,25,26)/b24-10+ |
| InChIKey | FPWSBYQWMUYDOI-YSURURNPSA-N |
| XLogP | 5.49 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|