C15H11Br4NO3 — CID 4630823
3,4-dibromo-2-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-6-ethoxyphenol (PubChem CID 4630823) has the molecular formula C15H11Br4NO3 and a molecular weight of 572.87 g/mol. Its IUPAC name is 3,4-dibromo-2-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-6-ethoxyphenol.
| Compound Name | 3,4-dibromo-2-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 4630823 |
| Molecular Formula | C15H11Br4NO3 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 568.75 |
| IUPAC Name | 3,4-dibromo-2-[(3,5-dibromo-4-hydroxyphenyl)iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2cc(Br)c(O)c(Br)c2)c1O |
| InChI | InChI=1S/C15H11Br4NO3/c1-2-23-12-5-9(16)13(19)8(14(12)21)6-20-7-3-10(17)15(22)11(18)4-7/h3-6,21-22H,2H2,1H3/b20-6+ |
| InChIKey | XRFNGHXQPMGQNC-CGOBSMCZSA-N |
| XLogP | 6.30 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|