C16H14Br2N2O5 — CID 4110397
3,4-dibromo-6-ethoxy-2-[(2-methoxy-5-nitrophenyl)iminomethyl]phenol (PubChem CID 4110397) has the molecular formula C16H14Br2N2O5 and a molecular weight of 474.11 g/mol. Its IUPAC name is 3,4-dibromo-6-ethoxy-2-[(2-methoxy-5-nitrophenyl)iminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-ethoxy-2-[(2-methoxy-5-nitrophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4110397 |
| Molecular Formula | C16H14Br2N2O5 |
| Molecular Weight | 474.11 g/mol |
| Exact Mass | 471.93 |
| IUPAC Name | 3,4-dibromo-6-ethoxy-2-[(2-methoxy-5-nitrophenyl)iminomethyl]phenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2cc([N+](=O)[O-])ccc2OC)c1O |
| InChI | InChI=1S/C16H14Br2N2O5/c1-3-25-14-7-11(17)15(18)10(16(14)21)8-19-12-6-9(20(22)23)4-5-13(12)24-2/h4-8,21H,3H2,1-2H3/b19-8+ |
| InChIKey | BMBDPWYIZASVPN-UFWORHAWSA-N |
| XLogP | 4.98 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.11 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|