C16H15Br2N3O4 — CID 4230585
3,4-dibromo-6-methoxy-2-[2-(4-nitroanilino)ethyliminomethyl]phenol (PubChem CID 4230585) has the molecular formula C16H15Br2N3O4 and a molecular weight of 473.12 g/mol. Its IUPAC name is 3,4-dibromo-6-methoxy-2-[2-(4-nitroanilino)ethyliminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-methoxy-2-[2-(4-nitroanilino)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 4230585 |
| Molecular Formula | C16H15Br2N3O4 |
| Molecular Weight | 473.12 g/mol |
| Exact Mass | 470.94 |
| IUPAC Name | 3,4-dibromo-6-methoxy-2-[2-(4-nitroanilino)ethyliminomethyl]phenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/CCNc2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C16H15Br2N3O4/c1-25-14-8-13(17)15(18)12(16(14)22)9-19-6-7-20-10-2-4-11(5-3-10)21(23)24/h2-5,8-9,20,22H,6-7H2,1H3/b19-9+ |
| InChIKey | IRIHSQZTYWKVDS-DJKKODMXSA-N |
| XLogP | 4.36 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.12 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|