C17H21N5O4 — CID 111033987
1-(3,4-dimethoxyphenyl)-2-[2-(4-nitroanilino)ethyl]guanidine (PubChem CID 111033987) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-(4-nitroanilino)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-(4-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111033987 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-(4-nitroanilino)ethyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCNc2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C17H21N5O4/c1-25-15-8-5-13(11-16(15)26-2)21-17(18)20-10-9-19-12-3-6-14(7-4-12)22(23)24/h3-8,11,19H,9-10H2,1-2H3,(H3,18,20,21) |
| InChIKey | OVUJDSNUPLPTEL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|