C18H23FN4O2 — CID 110032208
1-(3,4-dimethoxyphenyl)-2-[3-(3-fluoroanilino)propyl]guanidine (PubChem CID 110032208) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[3-(3-fluoroanilino)propyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[3-(3-fluoroanilino)propyl]guanidine |
|---|---|
| PubChem CID | 110032208 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[3-(3-fluoroanilino)propyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCCNc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C18H23FN4O2/c1-24-16-8-7-15(12-17(16)25-2)23-18(20)22-10-4-9-21-14-6-3-5-13(19)11-14/h3,5-8,11-12,21H,4,9-10H2,1-2H3,(H3,20,22,23) |
| InChIKey | JIRTVBVZHAKNQE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|