C12H19N5O2 — CID 111033963
1-[2-(4-nitroanilino)ethyl]-2-propylguanidine (PubChem CID 111033963) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[2-(4-nitroanilino)ethyl]-2-propylguanidine.
| Compound Name | 1-[2-(4-nitroanilino)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111033963 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-[2-(4-nitroanilino)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H19N5O2/c1-2-7-15-12(13)16-9-8-14-10-3-5-11(6-4-10)17(18)19/h3-6,14H,2,7-9H2,1H3,(H3,13,15,16) |
| InChIKey | YLQHBBMAJUDYEL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|