C16H16BrN3O4 — CID 9317011
3-bromo-4-methoxy-N-[2-(4-nitroanilino)ethyl]benzamide (PubChem CID 9317011) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[2-(4-nitroanilino)ethyl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[2-(4-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9317011 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-bromo-4-methoxy-N-[2-(4-nitroanilino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C16H16BrN3O4/c1-24-15-7-2-11(10-14(15)17)16(21)19-9-8-18-12-3-5-13(6-4-12)20(22)23/h2-7,10,18H,8-9H2,1H3,(H,19,21) |
| InChIKey | VJINCMMMDGJITG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|