C17H19N3O3 — CID 9308454
3,5-dimethyl-N-[2-(4-nitroanilino)ethyl]benzamide (PubChem CID 9308454) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(4-nitroanilino)ethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-(4-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9308454 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3,5-dimethyl-N-[2-(4-nitroanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCCNc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-12-9-13(2)11-14(10-12)17(21)19-8-7-18-15-3-5-16(6-4-15)20(22)23/h3-6,9-11,18H,7-8H2,1-2H3,(H,19,21) |
| InChIKey | MIMNSWVZKPPLFH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|