C18H20N4O4 — CID 46415597
4-(acetamidomethyl)-N-[2-(4-nitroanilino)ethyl]benzamide (PubChem CID 46415597) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-(acetamidomethyl)-N-[2-(4-nitroanilino)ethyl]benzamide.
| Compound Name | 4-(acetamidomethyl)-N-[2-(4-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 46415597 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-(acetamidomethyl)-N-[2-(4-nitroanilino)ethyl]benzamide |
| SMILES | CC(=O)NCc1ccc(C(=O)NCCNc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-13(23)21-12-14-2-4-15(5-3-14)18(24)20-11-10-19-16-6-8-17(9-7-16)22(25)26/h2-9,19H,10-12H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | CVFWHUIVRHHDOY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|