C16H17FN4O3 — CID 38233006
1-[(4-fluorophenyl)methyl]-3-[2-(4-nitroanilino)ethyl]urea (PubChem CID 38233006) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-(4-nitroanilino)ethyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-(4-nitroanilino)ethyl]urea |
|---|---|
| PubChem CID | 38233006 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-(4-nitroanilino)ethyl]urea |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN4O3/c17-13-3-1-12(2-4-13)11-20-16(22)19-10-9-18-14-5-7-15(8-6-14)21(23)24/h1-8,18H,9-11H2,(H2,19,20,22) |
| InChIKey | XIZJQGNKWVGQTA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|