C24H21F2N9O3 — CID 178078595
1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-nitrophenyl)urea (PubChem CID 178078595) has the molecular formula C24H21F2N9O3 and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 178078595 |
| Molecular Formula | C24H21F2N9O3 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-nitrophenyl)urea |
| SMILES | O=C(NNc1nc(NCc2ccc(F)cc2)nc(NCc2ccc(F)cc2)n1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21F2N9O3/c25-17-5-1-15(2-6-17)13-27-21-30-22(28-14-16-3-7-18(26)8-4-16)32-23(31-21)33-34-24(36)29-19-9-11-20(12-10-19)35(37)38/h1-12H,13-14H2,(H2,29,34,36)(H3,27,28,30,31,32,33) |
| InChIKey | UOJRUHAHAAGHLZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|