C24H21ClF2N8O — CID 178078599
1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-chlorophenyl)urea (PubChem CID 178078599) has the molecular formula C24H21ClF2N8O and a molecular weight of 510.94 g/mol. Its IUPAC name is 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 178078599 |
| Molecular Formula | C24H21ClF2N8O |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(4-chlorophenyl)urea |
| SMILES | O=C(NNc1nc(NCc2ccc(F)cc2)nc(NCc2ccc(F)cc2)n1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClF2N8O/c25-17-5-11-20(12-6-17)30-24(36)35-34-23-32-21(28-13-15-1-7-18(26)8-2-15)31-22(33-23)29-14-16-3-9-19(27)10-4-16/h1-12H,13-14H2,(H2,30,35,36)(H3,28,29,31,32,33,34) |
| InChIKey | PKJLMDJZGUGMBL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|