C24H21F3N8S — CID 178078613
1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(2-fluorophenyl)thiourea (PubChem CID 178078613) has the molecular formula C24H21F3N8S and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 178078613 |
| Molecular Formula | C24H21F3N8S |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[[4,6-bis[(4-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]-3-(2-fluorophenyl)thiourea |
| SMILES | Fc1ccc(CNc2nc(NCc3ccc(F)cc3)nc(NNC(=S)Nc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C24H21F3N8S/c25-17-9-5-15(6-10-17)13-28-21-31-22(29-14-16-7-11-18(26)12-8-16)33-23(32-21)34-35-24(36)30-20-4-2-1-3-19(20)27/h1-12H,13-14H2,(H2,30,35,36)(H3,28,29,31,32,33,34) |
| InChIKey | DGHQYISGJZFXQB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|