C13H14FN5S — CID 8655396
1-[(4,6-dimethylpyrimidin-2-yl)amino]-3-(4-fluorophenyl)thiourea (PubChem CID 8655396) has the molecular formula C13H14FN5S and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-[(4,6-dimethylpyrimidin-2-yl)amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(4,6-dimethylpyrimidin-2-yl)amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8655396 |
| Molecular Formula | C13H14FN5S |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[(4,6-dimethylpyrimidin-2-yl)amino]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)nc(NNC(=S)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H14FN5S/c1-8-7-9(2)16-12(15-8)18-19-13(20)17-11-5-3-10(14)4-6-11/h3-7H,1-2H3,(H,15,16,18)(H2,17,19,20) |
| InChIKey | IPLNKBZMUQECIW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|