C14H16ClN5S — CID 8655412
1-(3-chloro-2-methylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]thiourea (PubChem CID 8655412) has the molecular formula C14H16ClN5S and a molecular weight of 321.84 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 8655412 |
| Molecular Formula | C14H16ClN5S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]thiourea |
| SMILES | Cc1cc(C)nc(NNC(=S)Nc2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C14H16ClN5S/c1-8-7-9(2)17-13(16-8)19-20-14(21)18-12-6-4-5-11(15)10(12)3/h4-7H,1-3H3,(H,16,17,19)(H2,18,20,21) |
| InChIKey | DHTRNRWLWAUYTD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|