C23H23FN6O2S — CID 17089430
methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]carbamothioylamino]benzoate (PubChem CID 17089430) has the molecular formula C23H23FN6O2S and a molecular weight of 466.54 g/mol. Its IUPAC name is methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17089430 |
| Molecular Formula | C23H23FN6O2S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-[(4-fluorophenyl)methyl]carbamimidoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N/C(=N\Cc2ccc(F)cc2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H23FN6O2S/c1-14-12-15(2)27-22(26-14)29-21(25-13-16-4-8-18(24)9-5-16)30-23(33)28-19-10-6-17(7-11-19)20(31)32-3/h4-12H,13H2,1-3H3,(H3,25,26,27,28,29,30,33) |
| InChIKey | RHRHDWWAMBGJNK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|