C23H23ClN6O2S — CID 17089388
methyl 4-[[N'-[(2-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzoate (PubChem CID 17089388) has the molecular formula C23H23ClN6O2S and a molecular weight of 483.00 g/mol. Its IUPAC name is methyl 4-[[N'-[(2-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[N'-[(2-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17089388 |
| Molecular Formula | C23H23ClN6O2S |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | methyl 4-[[N'-[(2-chlorophenyl)methyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N/C(=N\Cc2ccccc2Cl)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H23ClN6O2S/c1-14-12-15(2)27-22(26-14)29-21(25-13-17-6-4-5-7-19(17)24)30-23(33)28-18-10-8-16(9-11-18)20(31)32-3/h4-12H,13H2,1-3H3,(H3,25,26,27,28,29,30,33) |
| InChIKey | IMOODZXQPZHNPP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|