C24H29N7OS — CID 17090060
1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea (PubChem CID 17090060) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea.
| Compound Name | 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090060 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea |
| SMILES | COCCC/N=C(\NC(=S)Nc1ccc(Nc2ccccc2)cc1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C24H29N7OS/c1-17-16-18(2)27-23(26-17)30-22(25-14-7-15-32-3)31-24(33)29-21-12-10-20(11-13-21)28-19-8-5-4-6-9-19/h4-6,8-13,16,28H,7,14-15H2,1-3H3,(H3,25,26,27,29,30,31,33) |
| InChIKey | ODBMCLYRAMMAGJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|