C25H26N8OS — CID 17089228
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 17089228) has the molecular formula C25H26N8OS and a molecular weight of 486.61 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089228 |
| Molecular Formula | C25H26N8OS |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2cnc[nH]2)NC(=S)Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H26N8OS/c1-17-14-18(2)30-24(29-17)32-23(27-13-12-20-15-26-16-28-20)33-25(35)31-19-8-10-22(11-9-19)34-21-6-4-3-5-7-21/h3-11,14-16H,12-13H2,1-2H3,(H,26,28)(H3,27,29,30,31,32,33,35) |
| InChIKey | ASHAIYJXBVYOTE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|