C20H24N8OS — CID 16584027
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 16584027) has the molecular formula C20H24N8OS and a molecular weight of 424.53 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 16584027 |
| Molecular Formula | C20H24N8OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N/C(=N\CCc1cnc[nH]1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C20H24N8OS/c1-13-10-14(2)25-19(24-13)27-18(22-9-8-15-11-21-12-23-15)28-20(30)26-16-6-4-5-7-17(16)29-3/h4-7,10-12H,8-9H2,1-3H3,(H,21,23)(H3,22,24,25,26,27,28,30) |
| InChIKey | TUZJLTHIZKXZPO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|