C25H26ClN7O2 — CID 17038140
1-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(2-methoxyphenyl)urea (PubChem CID 17038140) has the molecular formula C25H26ClN7O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is 1-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 17038140 |
| Molecular Formula | C25H26ClN7O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)N/C(=N\CCc1c[nH]c2ccc(Cl)cc12)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C25H26ClN7O2/c1-15-12-16(2)30-24(29-15)32-23(33-25(34)31-21-6-4-5-7-22(21)35-3)27-11-10-17-14-28-20-9-8-18(26)13-19(17)20/h4-9,12-14,28H,10-11H2,1-3H3,(H3,27,29,30,31,32,33,34) |
| InChIKey | JGANLUXOQJKJBV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|