C25H25ClN6O2 — CID 4896847
2-(4-chlorophenoxy)-N-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]acetamide (PubChem CID 4896847) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 4896847 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]acetamide |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2c[nH]c3ccccc23)NC(=O)COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C25H25ClN6O2/c1-16-13-17(2)30-25(29-16)32-24(31-23(33)15-34-20-9-7-19(26)8-10-20)27-12-11-18-14-28-22-6-4-3-5-21(18)22/h3-10,13-14,28H,11-12,15H2,1-2H3,(H2,27,29,30,31,32,33) |
| InChIKey | OAENUCVGSVGYNS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|