C28H29ClN6O3 — CID 4873887
N-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 4873887) has the molecular formula C28H29ClN6O3 and a molecular weight of 533.03 g/mol. Its IUPAC name is N-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4873887 |
| Molecular Formula | C28H29ClN6O3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[N'-[2-(5-chloro-1H-indol-3-yl)ethyl]-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)N/C(=N\CCc2c[nH]c3ccc(Cl)cc23)Nc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C28H29ClN6O3/c1-17-13-18(2)33-28(32-17)35-27(30-12-11-20-16-31-23-8-7-21(29)15-22(20)23)34-26(36)10-6-19-5-9-24(37-3)25(14-19)38-4/h5-10,13-16,31H,11-12H2,1-4H3,(H2,30,32,33,34,35,36) |
| InChIKey | YTPTTXSUZQNAKQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|