C27H31N7OS — CID 17089973
1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea (PubChem CID 17089973) has the molecular formula C27H31N7OS and a molecular weight of 501.66 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089973 |
| Molecular Formula | C27H31N7OS |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea |
| SMILES | COc1ccc2[nH]cc(CC/N=C(\NC(=S)Nc3cc(C)cc(C)c3)Nc3nc(C)cc(C)n3)c2c1 |
| InChI | InChI=1S/C27H31N7OS/c1-16-10-17(2)12-21(11-16)32-27(36)34-25(33-26-30-18(3)13-19(4)31-26)28-9-8-20-15-29-24-7-6-22(35-5)14-23(20)24/h6-7,10-15,29H,8-9H2,1-5H3,(H3,28,30,31,32,33,34,36) |
| InChIKey | YOTRZGJJRKGPOO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|