C24H31N7O2S — CID 17090001
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 17090001) has the molecular formula C24H31N7O2S and a molecular weight of 481.63 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17090001 |
| Molecular Formula | C24H31N7O2S |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc2[nH]cc(CC/N=C(\NC(=S)NCC3CCCO3)Nc3nc(C)cc(C)n3)c2c1 |
| InChI | InChI=1S/C24H31N7O2S/c1-15-11-16(2)29-23(28-15)30-22(31-24(34)27-14-19-5-4-10-33-19)25-9-8-17-13-26-21-7-6-18(32-3)12-20(17)21/h6-7,11-13,19,26H,4-5,8-10,14H2,1-3H3,(H3,25,27,28,29,30,31,34) |
| InChIKey | KONGIZXUNSVFND-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|