C21H26FN7OS — CID 17090112
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(2-methoxyethyl)thiourea (PubChem CID 17090112) has the molecular formula C21H26FN7OS and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 17090112 |
| Molecular Formula | C21H26FN7OS |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N/C(=N\CCc1c[nH]c2ccc(F)cc12)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C21H26FN7OS/c1-13-10-14(2)27-20(26-13)28-19(29-21(31)24-8-9-30-3)23-7-6-15-12-25-18-5-4-16(22)11-17(15)18/h4-5,10-12,25H,6-9H2,1-3H3,(H3,23,24,26,27,28,29,31) |
| InChIKey | NMPVXDAZIXQADM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|