C26H28FN7S — CID 17090091
1-(3,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea (PubChem CID 17090091) has the molecular formula C26H28FN7S and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090091 |
| Molecular Formula | C26H28FN7S |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2c[nH]c3ccc(F)cc23)NC(=S)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C26H28FN7S/c1-15-5-7-21(11-16(15)2)32-26(35)34-24(33-25-30-17(3)12-18(4)31-25)28-10-9-19-14-29-23-8-6-20(27)13-22(19)23/h5-8,11-14,29H,9-10H2,1-4H3,(H3,28,30,31,32,33,34,35) |
| InChIKey | NNCBOXVCMYVBKX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|