C25H24F3N7S — CID 17089881
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 17089881) has the molecular formula C25H24F3N7S and a molecular weight of 511.58 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17089881 |
| Molecular Formula | C25H24F3N7S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2c[nH]c3ccccc23)NC(=S)Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C25H24F3N7S/c1-15-13-16(2)32-23(31-15)34-22(29-12-11-17-14-30-21-6-4-3-5-20(17)21)35-24(36)33-19-9-7-18(8-10-19)25(26,27)28/h3-10,13-14,30H,11-12H2,1-2H3,(H3,29,31,32,33,34,35,36) |
| InChIKey | JCWPQKODBMYPBQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|