C20H21F3N8S — CID 16584044
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 16584044) has the molecular formula C20H21F3N8S and a molecular weight of 462.51 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 16584044 |
| Molecular Formula | C20H21F3N8S |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2cnc[nH]2)NC(=S)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H21F3N8S/c1-12-8-13(2)28-18(27-12)30-17(25-7-6-16-10-24-11-26-16)31-19(32)29-15-5-3-4-14(9-15)20(21,22)23/h3-5,8-11H,6-7H2,1-2H3,(H,24,26)(H3,25,27,28,29,30,31,32) |
| InChIKey | XPPZDRASISYXQN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|