C20H20ClN5O2 — CID 91310412
3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide (PubChem CID 91310412) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 91310412 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-chloro-N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide |
| SMILES | COc1cccc(N/C(=N/CCc2cnc[nH]2)NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-28-18-7-3-6-16(11-18)25-20(23-9-8-17-12-22-13-24-17)26-19(27)14-4-2-5-15(21)10-14/h2-7,10-13H,8-9H2,1H3,(H,22,24)(H2,23,25,26,27) |
| InChIKey | SPDPTNAGVOEBPN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|