C25H22N6O3 — CID 90854650
N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-phenylphenyl)carbamimidoyl]-4-nitrobenzamide (PubChem CID 90854650) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-phenylphenyl)carbamimidoyl]-4-nitrobenzamide.
| Compound Name | N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-phenylphenyl)carbamimidoyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 90854650 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[N'-[2-(1H-imidazol-5-yl)ethyl]-N-(3-phenylphenyl)carbamimidoyl]-4-nitrobenzamide |
| SMILES | O=C(N/C(=N\CCc1cnc[nH]1)Nc1cccc(-c2ccccc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H22N6O3/c32-24(19-9-11-23(12-10-19)31(33)34)30-25(27-14-13-22-16-26-17-28-22)29-21-8-4-7-20(15-21)18-5-2-1-3-6-18/h1-12,15-17H,13-14H2,(H,26,28)(H2,27,29,30,32) |
| InChIKey | STSQROUMKOROMH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|