C23H26ClN5O — CID 91167524
3-chloro-N-[N-(2,6-diethylphenyl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]benzamide (PubChem CID 91167524) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is 3-chloro-N-[N-(2,6-diethylphenyl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N-(2,6-diethylphenyl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 91167524 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-chloro-N-[N-(2,6-diethylphenyl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]benzamide |
| SMILES | CCc1cccc(CC)c1N/C(=N/CCc1cnc[nH]1)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H26ClN5O/c1-3-16-7-5-8-17(4-2)21(16)28-23(26-12-11-20-14-25-15-27-20)29-22(30)18-9-6-10-19(24)13-18/h5-10,13-15H,3-4,11-12H2,1-2H3,(H,25,27)(H2,26,28,29,30) |
| InChIKey | QWFFOCDTSYKHPK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|