C25H23ClN4O — CID 53209699
3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]benzamide (PubChem CID 53209699) has the molecular formula C25H23ClN4O and a molecular weight of 430.94 g/mol. Its IUPAC name is 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 53209699 |
| Molecular Formula | C25H23ClN4O |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]benzamide |
| SMILES | Cc1ccc(N/C(=N\CCc2c[nH]c3ccccc23)NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN4O/c1-17-9-11-21(12-10-17)29-25(30-24(31)18-5-4-6-20(26)15-18)27-14-13-19-16-28-23-8-3-2-7-22(19)23/h2-12,15-16,28H,13-14H2,1H3,(H2,27,29,30,31) |
| InChIKey | GZXGUULVOVHCFL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|