C27H27ClN4O — CID 46283046
3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide (PubChem CID 46283046) has the molecular formula C27H27ClN4O and a molecular weight of 458.99 g/mol. Its IUPAC name is 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46283046 |
| Molecular Formula | C27H27ClN4O |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-chloro-N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(4-propan-2-ylphenyl)carbamimidoyl]benzamide |
| SMILES | CC(C)c1ccc(N/C(=N\CCc2c[nH]c3ccccc23)NC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C27H27ClN4O/c1-18(2)19-10-12-23(13-11-19)31-27(32-26(33)20-6-5-7-22(28)16-20)29-15-14-21-17-30-25-9-4-3-8-24(21)25/h3-13,16-18,30H,14-15H2,1-2H3,(H2,29,31,32,33) |
| InChIKey | NSNQZFMRWGEYLC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|