C26H26N4O3 — CID 46282748
N-[N'-[2-(1H-indol-3-yl)ethyl]-N-phenylcarbamimidoyl]-3,4-dimethoxybenzamide (PubChem CID 46282748) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[N'-[2-(1H-indol-3-yl)ethyl]-N-phenylcarbamimidoyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[N'-[2-(1H-indol-3-yl)ethyl]-N-phenylcarbamimidoyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 46282748 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[N'-[2-(1H-indol-3-yl)ethyl]-N-phenylcarbamimidoyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=N/CCc2c[nH]c3ccccc23)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H26N4O3/c1-32-23-13-12-18(16-24(23)33-2)25(31)30-26(29-20-8-4-3-5-9-20)27-15-14-19-17-28-22-11-7-6-10-21(19)22/h3-13,16-17,28H,14-15H2,1-2H3,(H2,27,29,30,31) |
| InChIKey | OHGPGWBGAPCWSC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|