C26H25FN4O3 — CID 46283142
N-[N-(3,5-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-fluorobenzamide (PubChem CID 46283142) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is N-[N-(3,5-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(3,5-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46283142 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[N-(3,5-dimethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-fluorobenzamide |
| SMILES | COc1cc(N/C(=N/CCc2c[nH]c3ccccc23)NC(=O)c2ccc(F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H25FN4O3/c1-33-21-13-20(14-22(15-21)34-2)30-26(31-25(32)17-7-9-19(27)10-8-17)28-12-11-18-16-29-24-6-4-3-5-23(18)24/h3-10,13-16,29H,11-12H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | SJTFRNRIPCMQTD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|