C27H27FN4O4 — CID 46283126
N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 46283126) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46283126 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/C(=N/CCc2c[nH]c3ccccc23)Nc2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H27FN4O4/c1-34-23-13-18(14-24(35-2)25(23)36-3)26(33)32-27(31-20-8-6-7-19(28)15-20)29-12-11-17-16-30-22-10-5-4-9-21(17)22/h4-10,13-16,30H,11-12H2,1-3H3,(H2,29,31,32,33) |
| InChIKey | KZMNRSJSCZCVKE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|