C24H20F2N4O — CID 46283125
2-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide (PubChem CID 46283125) has the molecular formula C24H20F2N4O and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide.
| Compound Name | 2-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46283125 |
| Molecular Formula | C24H20F2N4O |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N/CCc1c[nH]c2ccccc12)Nc1cccc(F)c1)c1ccccc1F |
| InChI | InChI=1S/C24H20F2N4O/c25-17-6-5-7-18(14-17)29-24(30-23(31)20-9-1-3-10-21(20)26)27-13-12-16-15-28-22-11-4-2-8-19(16)22/h1-11,14-15,28H,12-13H2,(H2,27,29,30,31) |
| InChIKey | WYNFWYDQKWMPJZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|