C25H22ClFN4O — CID 46283009
N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-fluorobenzamide (PubChem CID 46283009) has the molecular formula C25H22ClFN4O and a molecular weight of 448.93 g/mol. Its IUPAC name is N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-fluorobenzamide.
| Compound Name | N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 46283009 |
| Molecular Formula | C25H22ClFN4O |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[N-(3-chloro-2-methylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-fluorobenzamide |
| SMILES | Cc1c(Cl)cccc1N/C(=N/CCc1c[nH]c2ccccc12)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C25H22ClFN4O/c1-16-20(26)9-6-12-22(16)30-25(31-24(32)19-8-2-4-10-21(19)27)28-14-13-17-15-29-23-11-5-3-7-18(17)23/h2-12,15,29H,13-14H2,1H3,(H2,28,30,31,32) |
| InChIKey | AREDKDORRNZUNU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|