C26H25ClN4O2 — CID 46283082
N-[N-(3-chloro-4-methoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methylbenzamide (PubChem CID 46283082) has the molecular formula C26H25ClN4O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is N-[N-(3-chloro-4-methoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methylbenzamide.
| Compound Name | N-[N-(3-chloro-4-methoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46283082 |
| Molecular Formula | C26H25ClN4O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[N-(3-chloro-4-methoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methylbenzamide |
| SMILES | COc1ccc(N/C(=N\CCc2c[nH]c3ccccc23)NC(=O)c2ccccc2C)cc1Cl |
| InChI | InChI=1S/C26H25ClN4O2/c1-17-7-3-4-8-20(17)25(32)31-26(30-19-11-12-24(33-2)22(27)15-19)28-14-13-18-16-29-23-10-6-5-9-21(18)23/h3-12,15-16,29H,13-14H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | JIGHGMBVKZGREP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|