C27H28N4O3 — CID 46282934
N-[N-(2-ethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methoxybenzamide (PubChem CID 46282934) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[N-(2-ethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methoxybenzamide.
| Compound Name | N-[N-(2-ethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46282934 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[N-(2-ethoxyphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-2-methoxybenzamide |
| SMILES | CCOc1ccccc1N/C(=N/CCc1c[nH]c2ccccc12)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C27H28N4O3/c1-3-34-25-15-9-7-13-23(25)30-27(31-26(32)21-11-5-8-14-24(21)33-2)28-17-16-19-18-29-22-12-6-4-10-20(19)22/h4-15,18,29H,3,16-17H2,1-2H3,(H2,28,30,31,32) |
| InChIKey | RCUBSLDANBLPSM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|