C28H31N5O — CID 46283107
3-(dimethylamino)-N-[N-(2,3-dimethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide (PubChem CID 46283107) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[N-(2,3-dimethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[N-(2,3-dimethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46283107 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 3-(dimethylamino)-N-[N-(2,3-dimethylphenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]benzamide |
| SMILES | Cc1cccc(N/C(=N/CCc2c[nH]c3ccccc23)NC(=O)c2cccc(N(C)C)c2)c1C |
| InChI | InChI=1S/C28H31N5O/c1-19-9-7-14-25(20(19)2)31-28(32-27(34)21-10-8-11-23(17-21)33(3)4)29-16-15-22-18-30-26-13-6-5-12-24(22)26/h5-14,17-18,30H,15-16H2,1-4H3,(H2,29,31,32,34) |
| InChIKey | DAMAKIBTMJFIIO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|