C23H28N4O — CID 46282878
N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(2-methylphenyl)carbamimidoyl]pentanamide (PubChem CID 46282878) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(2-methylphenyl)carbamimidoyl]pentanamide.
| Compound Name | N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(2-methylphenyl)carbamimidoyl]pentanamide |
|---|---|
| PubChem CID | 46282878 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[N'-[2-(1H-indol-3-yl)ethyl]-N-(2-methylphenyl)carbamimidoyl]pentanamide |
| SMILES | CCCCC(=O)N/C(=N\CCc1c[nH]c2ccccc12)Nc1ccccc1C |
| InChI | InChI=1S/C23H28N4O/c1-3-4-13-22(28)27-23(26-20-11-7-5-9-17(20)2)24-15-14-18-16-25-21-12-8-6-10-19(18)21/h5-12,16,25H,3-4,13-15H2,1-2H3,(H2,24,26,27,28) |
| InChIKey | HKWDXHBUZPKUOH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|