C25H22F2N4O — CID 53209726
3-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 53209726) has the molecular formula C25H22F2N4O and a molecular weight of 432.47 g/mol. Its IUPAC name is 3-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 53209726 |
| Molecular Formula | C25H22F2N4O |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-fluoro-N-[N-(3-fluorophenyl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=N\CCc2c[nH]c3ccccc23)Nc2cccc(F)c2)cc1F |
| InChI | InChI=1S/C25H22F2N4O/c1-16-9-10-17(13-22(16)27)24(32)31-25(30-20-6-4-5-19(26)14-20)28-12-11-18-15-29-23-8-3-2-7-21(18)23/h2-10,13-15,29H,11-12H2,1H3,(H2,28,30,31,32) |
| InChIKey | PCWAVAMTWDJTOA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|