C15H19N3O — CID 110684155
N-(2,6-diethylphenyl)-2-(1H-imidazol-5-yl)acetamide (PubChem CID 110684155) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110684155 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(1H-imidazol-5-yl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C15H19N3O/c1-3-11-6-5-7-12(4-2)15(11)18-14(19)8-13-9-16-10-17-13/h5-7,9-10H,3-4,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | USLLXWOVUZWHNS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |