C12H13ClN2 — CID 24738219
5-[(2-chloro-6-ethylphenyl)methyl]-1H-imidazole (PubChem CID 24738219) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 5-[(2-chloro-6-ethylphenyl)methyl]-1H-imidazole.
| Compound Name | 5-[(2-chloro-6-ethylphenyl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 24738219 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-[(2-chloro-6-ethylphenyl)methyl]-1H-imidazole |
| SMILES | CCc1cccc(Cl)c1Cc1cnc[nH]1 |
| InChI | InChI=1S/C12H13ClN2/c1-2-9-4-3-5-12(13)11(9)6-10-7-14-8-15-10/h3-5,7-8H,2,6H2,1H3,(H,14,15) |
| InChIKey | UCHBEAKKNVDHCS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |